C23H36F2O — CID 170201857
(3R,10R,13S,17E)-3-(difluoromethyl)-5,13-dimethyl-17-propylidene-2,4,6,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 170201857) has the molecular formula C23H36F2O and a molecular weight of 366.54 g/mol. Its IUPAC name is (3R,10R,13S,17E)-3-(difluoromethyl)-5,13-dimethyl-17-propylidene-2,4,6,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,10R,13S,17E)-3-(difluoromethyl)-5,13-dimethyl-17-propylidene-2,4,6,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 170201857 |
| Molecular Formula | C23H36F2O |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | (3R,10R,13S,17E)-3-(difluoromethyl)-5,13-dimethyl-17-propylidene-2,4,6,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC/C=C1\CCC2C3CCC4(C)C[C@@](O)(C(F)F)CC[C@@H]4C3CC[C@]12C |
| InChI | InChI=1S/C23H36F2O/c1-4-5-15-6-7-19-17-8-11-21(2)14-23(26,20(24)25)13-10-18(21)16(17)9-12-22(15,19)3/h5,16-20,26H,4,6-14H2,1-3H3/b15-5+/t16?,17?,18-,19?,21?,22-,23-/m1/s1 |
| InChIKey | DMPXXKAMZIAFFJ-NDDPKCDCSA-N |
| XLogP | 6.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|