C22H38F2 — CID 144732611
(3Z)-7-(2,2-difluoroethyl)-3-ethylidene-3a-methyl-6-propyl-2,4,5,5a,6,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene;methane (PubChem CID 144732611) has the molecular formula C22H38F2 and a molecular weight of 340.54 g/mol. Its IUPAC name is (3Z)-7-(2,2-difluoroethyl)-3-ethylidene-3a-methyl-6-propyl-2,4,5,5a,6,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene;methane.
| Compound Name | (3Z)-7-(2,2-difluoroethyl)-3-ethylidene-3a-methyl-6-propyl-2,4,5,5a,6,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene;methane |
|---|---|
| PubChem CID | 144732611 |
| Molecular Formula | C22H38F2 |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.29 |
| IUPAC Name | (3Z)-7-(2,2-difluoroethyl)-3-ethylidene-3a-methyl-6-propyl-2,4,5,5a,6,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene;methane |
| SMILES | C.C/C=C1/CCC2C3CCC(CC(F)F)C(CCC)C3CCC12C |
| InChI | InChI=1S/C21H34F2.CH4/c1-4-6-16-14(13-20(22)23)7-9-18-17(16)11-12-21(3)15(5-2)8-10-19(18)21;/h5,14,16-20H,4,6-13H2,1-3H3;1H4/b15-5-; |
| InChIKey | QPMXETZJSLRDHE-PZTRBQFESA-N |
| XLogP | 7.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|