C25H43NO — CID 143964106
acetylene;4-[(3R,10S,13R,17S)-3-amino-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butan-1-ol (PubChem CID 143964106) has the molecular formula C25H43NO and a molecular weight of 373.63 g/mol. Its IUPAC name is acetylene;4-[(3R,10S,13R,17S)-3-amino-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butan-1-ol.
| Compound Name | acetylene;4-[(3R,10S,13R,17S)-3-amino-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butan-1-ol |
|---|---|
| PubChem CID | 143964106 |
| Molecular Formula | C25H43NO |
| Molecular Weight | 373.63 g/mol |
| Exact Mass | 373.33 |
| IUPAC Name | acetylene;4-[(3R,10S,13R,17S)-3-amino-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butan-1-ol |
| SMILES | C#C.C[C@]12CC[C@@H](N)CC1CCC1C2CC[C@@]2(C)C1CC[C@@H]2CCCCO |
| InChI | InChI=1S/C23H41NO.C2H2/c1-22-13-11-21-19(20(22)9-7-16(22)5-3-4-14-25)8-6-17-15-18(24)10-12-23(17,21)2;1-2/h16-21,25H,3-15,24H2,1-2H3;1-2H/t16-,17?,18+,19?,20?,21?,22+,23-;/m0./s1 |
| InChIKey | YAKAPRGDEYTEEX-DBLUKIKASA-N |
| XLogP | 5.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.63 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|