C42H70O4S — CID 130339076
bis[(3R,5R,8S,9S,10S,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] sulfate (PubChem CID 130339076) has the molecular formula C42H70O4S and a molecular weight of 671.09 g/mol. Its IUPAC name is bis[(3R,5R,8S,9S,10S,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] sulfate.
| Compound Name | bis[(3R,5R,8S,9S,10S,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] sulfate |
|---|---|
| PubChem CID | 130339076 |
| Molecular Formula | C42H70O4S |
| Molecular Weight | 671.09 g/mol |
| Exact Mass | 670.50 |
| IUPAC Name | bis[(3R,5R,8S,9S,10S,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] sulfate |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](OS(=O)(=O)O[C@@H]5CC[C@@]6(C)[C@H](CC[C@@H]7[C@@H]6CC[C@]6(C)[C@@H](CC)CC[C@@H]76)C5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C42H70O4S/c1-7-27-11-15-35-33-13-9-29-25-31(17-21-41(29,5)37(33)19-23-39(27,35)3)45-47(43,44)46-32-18-22-42(6)30(26-32)10-14-34-36-16-12-28(8-2)40(36,4)24-20-38(34)42/h27-38H,7-26H2,1-6H3/t27-,28-,29+,30+,31+,32+,33-,34-,35-,36-,37-,38-,39+,40+,41-,42-/m0/s1 |
| InChIKey | RIEYDIWRESLPER-VPEWRVCBSA-N |
| XLogP | 11.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.09 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |