C21H38O4S — CID 158607456
(8S,9S,10S,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;sulfuric acid (PubChem CID 158607456) has the molecular formula C21H38O4S and a molecular weight of 386.60 g/mol. Its IUPAC name is (8S,9S,10S,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;sulfuric acid.
| Compound Name | (8S,9S,10S,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;sulfuric acid |
|---|---|
| PubChem CID | 158607456 |
| Molecular Formula | C21H38O4S |
| Molecular Weight | 386.60 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | (8S,9S,10S,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;sulfuric acid |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C.O=S(=O)(O)O |
| InChI | InChI=1S/C21H36.H2O4S/c1-4-15-9-11-18-17-10-8-16-7-5-6-13-20(16,2)19(17)12-14-21(15,18)3;1-5(2,3)4/h15-19H,4-14H2,1-3H3;(H2,1,2,3,4)/t15-,16?,17-,18-,19-,20-,21+;/m0./s1 |
| InChIKey | HWKJHWWGPNCBBN-XNKUGNQISA-N |
| XLogP | 5.79 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.60 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|