C21H34O — CID 164822332
(5S,8R,9S,10S,13S,14S,17S)-17-ethyl-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-13-carbaldehyde (PubChem CID 164822332) has the molecular formula C21H34O and a molecular weight of 302.50 g/mol. Its IUPAC name is (5S,8R,9S,10S,13S,14S,17S)-17-ethyl-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-13-carbaldehyde.
| Compound Name | (5S,8R,9S,10S,13S,14S,17S)-17-ethyl-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-13-carbaldehyde |
|---|---|
| PubChem CID | 164822332 |
| Molecular Formula | C21H34O |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | (5S,8R,9S,10S,13S,14S,17S)-17-ethyl-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-13-carbaldehyde |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4CCCC[C@]4(C)[C@H]3CC[C@]12C=O |
| InChI | InChI=1S/C21H34O/c1-3-15-8-10-19-17-9-7-16-6-4-5-12-20(16,2)18(17)11-13-21(15,19)14-22/h14-19H,3-13H2,1-2H3/t15-,16-,17+,18-,19-,20-,21-/m0/s1 |
| InChIKey | MSZGDMFMUIATIC-YQUGOWONSA-N |
| XLogP | 5.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|