C21H35NO — CID 154260335
N-[[(5R,8S,9S,10R,13R,14S,17S)-17-ethyl-13-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-10-yl]methylidene]hydroxylamine (PubChem CID 154260335) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is N-[[(5R,8S,9S,10R,13R,14S,17S)-17-ethyl-13-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-10-yl]methylidene]hydroxylamine.
| Compound Name | N-[[(5R,8S,9S,10R,13R,14S,17S)-17-ethyl-13-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-10-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 154260335 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | N-[[(5R,8S,9S,10R,13R,14S,17S)-17-ethyl-13-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-10-yl]methylidene]hydroxylamine |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CC[C@H]4CCCC[C@]4(C=NO)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H35NO/c1-3-15-8-10-18-17-9-7-16-6-4-5-12-21(16,14-22-23)19(17)11-13-20(15,18)2/h14-19,23H,3-13H2,1-2H3/t15-,16+,17-,18-,19-,20+,21+/m0/s1 |
| InChIKey | FGPSSWOJXXKAKD-OKCDGQADSA-N |
| XLogP | 5.89 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|