C40H66O4S — CID 130339110
bis[(2R,4aS,4bS,6aS,10bS,12aR)-4a,6a-dimethyl-1,2,3,4,4b,5,6,7,8,9,10,10a,10b,11,12,12a-hexadecahydrochrysen-2-yl] sulfate (PubChem CID 130339110) has the molecular formula C40H66O4S and a molecular weight of 643.03 g/mol. Its IUPAC name is bis[(2R,4aS,4bS,6aS,10bS,12aR)-4a,6a-dimethyl-1,2,3,4,4b,5,6,7,8,9,10,10a,10b,11,12,12a-hexadecahydrochrysen-2-yl] sulfate.
| Compound Name | bis[(2R,4aS,4bS,6aS,10bS,12aR)-4a,6a-dimethyl-1,2,3,4,4b,5,6,7,8,9,10,10a,10b,11,12,12a-hexadecahydrochrysen-2-yl] sulfate |
|---|---|
| PubChem CID | 130339110 |
| Molecular Formula | C40H66O4S |
| Molecular Weight | 643.03 g/mol |
| Exact Mass | 642.47 |
| IUPAC Name | bis[(2R,4aS,4bS,6aS,10bS,12aR)-4a,6a-dimethyl-1,2,3,4,4b,5,6,7,8,9,10,10a,10b,11,12,12a-hexadecahydrochrysen-2-yl] sulfate |
| SMILES | C[C@@]12CCCCC1[C@@H]1CC[C@@H]3C[C@H](OS(=O)(=O)O[C@@H]4CC[C@@]5(C)[C@H](CC[C@H]6C7CCCC[C@@]7(C)CC[C@@H]65)C4)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C40H66O4S/c1-37-19-7-5-9-33(37)31-13-11-27-25-29(15-23-39(27,3)35(31)17-21-37)43-45(41,42)44-30-16-24-40(4)28(26-30)12-14-32-34-10-6-8-20-38(34,2)22-18-36(32)40/h27-36H,5-26H2,1-4H3/t27-,28-,29-,30-,31+,32+,33?,34?,35+,36+,37+,38+,39+,40+/m1/s1 |
| InChIKey | RGWHZDQABNOBSO-DAVUYQQTSA-N |
| XLogP | 10.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.03 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |