C30H50O4S — CID 130339175
bis[(2S,4aR,4bR,8aS,10aS)-4a-methyl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthren-2-yl] sulfate (PubChem CID 130339175) has the molecular formula C30H50O4S and a molecular weight of 506.79 g/mol. Its IUPAC name is bis[(2S,4aR,4bR,8aS,10aS)-4a-methyl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthren-2-yl] sulfate.
| Compound Name | bis[(2S,4aR,4bR,8aS,10aS)-4a-methyl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthren-2-yl] sulfate |
|---|---|
| PubChem CID | 130339175 |
| Molecular Formula | C30H50O4S |
| Molecular Weight | 506.79 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | bis[(2S,4aR,4bR,8aS,10aS)-4a-methyl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthren-2-yl] sulfate |
| SMILES | C[C@@]12CC[C@H](OS(=O)(=O)O[C@H]3CC[C@]4(C)[C@@H](CC[C@@H]5CCCC[C@H]54)C3)C[C@@H]1CC[C@@H]1CCCC[C@H]12 |
| InChI | InChI=1S/C30H50O4S/c1-29-17-15-25(19-23(29)13-11-21-7-3-5-9-27(21)29)33-35(31,32)34-26-16-18-30(2)24(20-26)14-12-22-8-4-6-10-28(22)30/h21-28H,3-20H2,1-2H3/t21-,22-,23-,24-,25-,26-,27+,28+,29+,30+/m0/s1 |
| InChIKey | YTDUDBKLEUKWCW-BRNBTLORSA-N |
| XLogP | 7.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.79 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |