C13H24 — CID 168971709
2-cyclopropyl-2-methylbicyclo[3.2.0]heptane;ethane (PubChem CID 168971709) has the molecular formula C13H24 and a molecular weight of 180.34 g/mol. Its IUPAC name is 2-cyclopropyl-2-methylbicyclo[3.2.0]heptane;ethane.
| Compound Name | 2-cyclopropyl-2-methylbicyclo[3.2.0]heptane;ethane |
|---|---|
| PubChem CID | 168971709 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.34 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 2-cyclopropyl-2-methylbicyclo[3.2.0]heptane;ethane |
| SMILES | CC.CC1(C2CC2)CCC2CCC21 |
| InChI | InChI=1S/C11H18.C2H6/c1-11(9-3-4-9)7-6-8-2-5-10(8)11;1-2/h8-10H,2-7H2,1H3;1-2H3 |
| InChIKey | JJAFYYZUKUMRJK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |