C15H26O4S — CID 135197476
[(2R,4aS,8aR,10aR)-4a-methyl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthren-2-yl] hydrogen sulfate (PubChem CID 135197476) has the molecular formula C15H26O4S and a molecular weight of 302.44 g/mol. Its IUPAC name is [(2R,4aS,8aR,10aR)-4a-methyl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthren-2-yl] hydrogen sulfate.
| Compound Name | [(2R,4aS,8aR,10aR)-4a-methyl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthren-2-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 135197476 |
| Molecular Formula | C15H26O4S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | [(2R,4aS,8aR,10aR)-4a-methyl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthren-2-yl] hydrogen sulfate |
| SMILES | C[C@]12CC[C@@H](OS(=O)(=O)O)C[C@H]1CC[C@H]1CCCCC12 |
| InChI | InChI=1S/C15H26O4S/c1-15-9-8-13(19-20(16,17)18)10-12(15)7-6-11-4-2-3-5-14(11)15/h11-14H,2-10H2,1H3,(H,16,17,18)/t11-,12-,13-,14?,15+/m1/s1 |
| InChIKey | KPRKJNJGJSVLJE-LQYNHAPHSA-N |
| XLogP | 3.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|