C18H30O8S2 — CID 132938144
[(3R,5R,8R,9R,10S,13S,14S,17S)-13-methyl-3-sulfooxy-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl] hydrogen sulfate (PubChem CID 132938144) has the molecular formula C18H30O8S2 and a molecular weight of 438.56 g/mol. Its IUPAC name is [(3R,5R,8R,9R,10S,13S,14S,17S)-13-methyl-3-sulfooxy-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl] hydrogen sulfate.
| Compound Name | [(3R,5R,8R,9R,10S,13S,14S,17S)-13-methyl-3-sulfooxy-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 132938144 |
| Molecular Formula | C18H30O8S2 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | [(3R,5R,8R,9R,10S,13S,14S,17S)-13-methyl-3-sulfooxy-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl] hydrogen sulfate |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](OS(=O)(=O)O)CC[C@@H]43)[C@@H]1CC[C@@H]2OS(=O)(=O)O |
| InChI | InChI=1S/C18H30O8S2/c1-18-9-8-14-13-5-3-12(25-27(19,20)21)10-11(13)2-4-15(14)16(18)6-7-17(18)26-28(22,23)24/h11-17H,2-10H2,1H3,(H,19,20,21)(H,22,23,24)/t11-,12-,13+,14-,15-,16+,17+,18+/m1/s1 |
| InChIKey | XOLKEXSPWHECGD-QPZWGXJQSA-N |
| XLogP | 3.02 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|