C26H31F5O6S — CID 71499861
[(3R,5R,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3-sulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,3,4,5,6-pentafluorobenzoate (PubChem CID 71499861) has the molecular formula C26H31F5O6S and a molecular weight of 566.59 g/mol. Its IUPAC name is [(3R,5R,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3-sulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | [(3R,5R,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3-sulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 71499861 |
| Molecular Formula | C26H31F5O6S |
| Molecular Weight | 566.59 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | [(3R,5R,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3-sulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,3,4,5,6-pentafluorobenzoate |
| SMILES | C[C@]12CC[C@@H](OS(=O)(=O)O)C[C@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](OC(=O)c3c(F)c(F)c(F)c(F)c3F)CC[C@@H]12 |
| InChI | InChI=1S/C26H31F5O6S/c1-25-9-7-13(37-38(33,34)35)11-12(25)3-4-14-15-5-6-17(26(15,2)10-8-16(14)25)36-24(32)18-19(27)21(29)23(31)22(30)20(18)28/h12-17H,3-11H2,1-2H3,(H,33,34,35)/t12-,13-,14+,15+,16+,17+,25+,26+/m1/s1 |
| InChIKey | MNSGAZDSHLBMCL-VFLDMKKBSA-N |
| XLogP | 6.14 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.59 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|