C31H36F5NO6S — CID 71533588
[(3R,5R,10S,13S,17R)-10,13-dimethyl-3-sulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,3,4,5,6-pentafluorobenzoate;pyridine (PubChem CID 71533588) has the molecular formula C31H36F5NO6S and a molecular weight of 645.69 g/mol. Its IUPAC name is [(3R,5R,10S,13S,17R)-10,13-dimethyl-3-sulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,3,4,5,6-pentafluorobenzoate;pyridine.
| Compound Name | [(3R,5R,10S,13S,17R)-10,13-dimethyl-3-sulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,3,4,5,6-pentafluorobenzoate;pyridine |
|---|---|
| PubChem CID | 71533588 |
| Molecular Formula | C31H36F5NO6S |
| Molecular Weight | 645.69 g/mol |
| Exact Mass | 645.22 |
| IUPAC Name | [(3R,5R,10S,13S,17R)-10,13-dimethyl-3-sulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2,3,4,5,6-pentafluorobenzoate;pyridine |
| SMILES | C[C@]12CCC3C(CC[C@@H]4C[C@H](OS(=O)(=O)O)CC[C@]34C)C1CC[C@H]2OC(=O)c1c(F)c(F)c(F)c(F)c1F.c1ccncc1 |
| InChI | InChI=1S/C26H31F5O6S.C5H5N/c1-25-9-7-13(37-38(33,34)35)11-12(25)3-4-14-15-5-6-17(26(15,2)10-8-16(14)25)36-24(32)18-19(27)21(29)23(31)22(30)20(18)28;1-2-4-6-5-3-1/h12-17H,3-11H2,1-2H3,(H,33,34,35);1-5H/t12-,13-,14?,15?,16?,17-,25+,26+;/m1./s1 |
| InChIKey | GSNZANXUGQXSAC-KHFNLWMQSA-N |
| XLogP | 7.22 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.69 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|