C25H38N4O4S — CID 53484055
[(5R,10S,13S,17S)-17-(azidomethyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate;pyridine (PubChem CID 53484055) has the molecular formula C25H38N4O4S and a molecular weight of 490.67 g/mol. Its IUPAC name is [(5R,10S,13S,17S)-17-(azidomethyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate;pyridine.
| Compound Name | [(5R,10S,13S,17S)-17-(azidomethyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate;pyridine |
|---|---|
| PubChem CID | 53484055 |
| Molecular Formula | C25H38N4O4S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | [(5R,10S,13S,17S)-17-(azidomethyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate;pyridine |
| SMILES | C[C@]12CCC3C(CC[C@@H]4CC(OS(=O)(=O)O)CC[C@]34C)C1CC[C@@H]2CN=[N+]=[N-].c1ccncc1 |
| InChI | InChI=1S/C20H33N3O4S.C5H5N/c1-19-9-7-15(27-28(24,25)26)11-13(19)3-5-16-17-6-4-14(12-22-23-21)20(17,2)10-8-18(16)19;1-2-4-6-5-3-1/h13-18H,3-12H2,1-2H3,(H,24,25,26);1-5H/t13-,14-,15?,16?,17?,18?,19+,20-;/m1./s1 |
| InChIKey | NSENOWAIIRDQTM-PNLQIVFCSA-N |
| XLogP | 6.23 |
| TPSA | 125.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|