C24H37NO4S — CID 122182430
[(3R,5R,8S,9S,10S,13S,14R,17R)-10,17-dimethyl-1,2,3,4,5,6,7,8,9,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-3-yl] hydrogen sulfate;pyridine (PubChem CID 122182430) has the molecular formula C24H37NO4S and a molecular weight of 435.63 g/mol. Its IUPAC name is [(3R,5R,8S,9S,10S,13S,14R,17R)-10,17-dimethyl-1,2,3,4,5,6,7,8,9,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-3-yl] hydrogen sulfate;pyridine.
| Compound Name | [(3R,5R,8S,9S,10S,13S,14R,17R)-10,17-dimethyl-1,2,3,4,5,6,7,8,9,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-3-yl] hydrogen sulfate;pyridine |
|---|---|
| PubChem CID | 122182430 |
| Molecular Formula | C24H37NO4S |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | [(3R,5R,8S,9S,10S,13S,14R,17R)-10,17-dimethyl-1,2,3,4,5,6,7,8,9,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-3-yl] hydrogen sulfate;pyridine |
| SMILES | C[C@@H]1CC[C@@H]2[C@H]1CC[C@H]1[C@H]2CC[C@@H]2C[C@H](OS(=O)(=O)O)CC[C@@]21C.c1ccncc1 |
| InChI | InChI=1S/C19H32O4S.C5H5N/c1-12-3-5-16-15(12)7-8-18-17(16)6-4-13-11-14(23-24(20,21)22)9-10-19(13,18)2;1-2-4-6-5-3-1/h12-18H,3-11H2,1-2H3,(H,20,21,22);1-5H/t12-,13-,14-,15+,16-,17+,18+,19+;/m1./s1 |
| InChIKey | KNXDJTHNHDCPRF-XQFNSDKMSA-N |
| XLogP | 5.54 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|