C11H18 — CID 149005122
2-cyclopropyl-2-methylbicyclo[3.2.0]heptane (PubChem CID 149005122) has the molecular formula C11H18 and a molecular weight of 150.27 g/mol. Its IUPAC name is 2-cyclopropyl-2-methylbicyclo[3.2.0]heptane.
| Compound Name | 2-cyclopropyl-2-methylbicyclo[3.2.0]heptane |
|---|---|
| PubChem CID | 149005122 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.27 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 2-cyclopropyl-2-methylbicyclo[3.2.0]heptane |
| SMILES | CC1(C2CC2)CCC2CCC21 |
| InChI | InChI=1S/C11H18/c1-11(9-3-4-9)7-6-8-2-5-10(8)11/h8-10H,2-7H2,1H3 |
| InChIKey | YSSOLEFNIBHGCI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |