C11H18 — CID 58931798
(2R,6S)-2-methyltricyclo[5.2.1.02,6]decane (PubChem CID 58931798) has the molecular formula C11H18 and a molecular weight of 150.27 g/mol. Its IUPAC name is (2R,6S)-2-methyltricyclo[5.2.1.02,6]decane.
| Compound Name | (2R,6S)-2-methyltricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 58931798 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.27 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | (2R,6S)-2-methyltricyclo[5.2.1.02,6]decane |
| SMILES | C[C@]12CCC[C@H]1C1CCC2C1 |
| InChI | InChI=1S/C11H18/c1-11-6-2-3-10(11)8-4-5-9(11)7-8/h8-10H,2-7H2,1H3/t8?,9?,10-,11+/m0/s1 |
| InChIKey | FSFVSTVQJCVHTR-WFBLGPOFSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |