C16H28 — CID 140589212
6,6,9a-trimethyl-2,3,3a,4,5,5a,7,8,9,9b-decahydro-1H-cyclopenta[a]naphthalene (PubChem CID 140589212) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is 6,6,9a-trimethyl-2,3,3a,4,5,5a,7,8,9,9b-decahydro-1H-cyclopenta[a]naphthalene.
| Compound Name | 6,6,9a-trimethyl-2,3,3a,4,5,5a,7,8,9,9b-decahydro-1H-cyclopenta[a]naphthalene |
|---|---|
| PubChem CID | 140589212 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | 6,6,9a-trimethyl-2,3,3a,4,5,5a,7,8,9,9b-decahydro-1H-cyclopenta[a]naphthalene |
| SMILES | CC1(C)CCCC2(C)C3CCCC3CCC12 |
| InChI | InChI=1S/C16H28/c1-15(2)10-5-11-16(3)13-7-4-6-12(13)8-9-14(15)16/h12-14H,4-11H2,1-3H3 |
| InChIKey | HFLYANWTEZGTGH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |