C13H24O — CID 90388768
(1S,3aS,7aR)-1-methoxy-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 90388768) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is (1S,3aS,7aR)-1-methoxy-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | (1S,3aS,7aR)-1-methoxy-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 90388768 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (1S,3aS,7aR)-1-methoxy-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | CO[C@H]1CC[C@H]2C(C)(C)CCC[C@@]12C |
| InChI | InChI=1S/C13H24O/c1-12(2)8-5-9-13(3)10(12)6-7-11(13)14-4/h10-11H,5-9H2,1-4H3/t10-,11-,13+/m0/s1 |
| InChIKey | UYBPXWMQHHEINW-GMXVVIOVSA-N |
| XLogP | 3.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |