C18H32 — CID 162890936
(4aS,4bS,8aS,10aR)-4b,8,8,10a-tetramethyl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthrene (PubChem CID 162890936) has the molecular formula C18H32 and a molecular weight of 248.45 g/mol. Its IUPAC name is (4aS,4bS,8aS,10aR)-4b,8,8,10a-tetramethyl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthrene.
| Compound Name | (4aS,4bS,8aS,10aR)-4b,8,8,10a-tetramethyl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthrene |
|---|---|
| PubChem CID | 162890936 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | (4aS,4bS,8aS,10aR)-4b,8,8,10a-tetramethyl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthrene |
| SMILES | CC1(C)CCC[C@@]2(C)[C@H]1CC[C@@]1(C)CCCC[C@@H]12 |
| InChI | InChI=1S/C18H32/c1-16(2)10-7-12-18(4)14(16)9-13-17(3)11-6-5-8-15(17)18/h14-15H,5-13H2,1-4H3/t14-,15-,17+,18-/m0/s1 |
| InChIKey | JMIXISMLYBDEMM-ONIAQPFYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |