C20H34O — CID 23254326
(1S,4S,9S,10R,13S,14S,15R)-14,15-dideuterio-5,5,9,13-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadecan-16-ol (PubChem CID 23254326) has the molecular formula C20H34O and a molecular weight of 292.50 g/mol. Its IUPAC name is (1S,4S,9S,10R,13S,14S,15R)-14,15-dideuterio-5,5,9,13-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadecan-16-ol.
| Compound Name | (1S,4S,9S,10R,13S,14S,15R)-14,15-dideuterio-5,5,9,13-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadecan-16-ol |
|---|---|
| PubChem CID | 23254326 |
| Molecular Formula | C20H34O |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.27 |
| IUPAC Name | (1S,4S,9S,10R,13S,14S,15R)-14,15-dideuterio-5,5,9,13-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadecan-16-ol |
| SMILES | [2H][C@@H]1[C@H]([2H])[C@]2(C)CC[C@@H]3[C@@]4(C)CCCC(C)(C)[C@@H]4CC[C@]13C2O |
| InChI | InChI=1S/C20H34O/c1-17(2)8-5-9-19(4)14(17)7-11-20-13-12-18(3,16(20)21)10-6-15(19)20/h14-16,21H,5-13H2,1-4H3/t14-,15+,16?,18-,19-,20-/m0/s1/i12D,13D/t12-,13+,14-,15+,16?,18-,19-,20- |
| InChIKey | JTLWKHYHRPKKSV-QJDNOQARSA-N |
| XLogP | 5.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |