C21H37NOS — CID 90467252
4,4,11b-trimethyl-6a-(methylaminomethyl)-9-(sulfanylmethyl)-1,2,3,4a,5,6,7,10,11,11a-decahydrocyclohepta[a]naphthalen-7-ol (PubChem CID 90467252) has the molecular formula C21H37NOS and a molecular weight of 351.60 g/mol. Its IUPAC name is 4,4,11b-trimethyl-6a-(methylaminomethyl)-9-(sulfanylmethyl)-1,2,3,4a,5,6,7,10,11,11a-decahydrocyclohepta[a]naphthalen-7-ol.
| Compound Name | 4,4,11b-trimethyl-6a-(methylaminomethyl)-9-(sulfanylmethyl)-1,2,3,4a,5,6,7,10,11,11a-decahydrocyclohepta[a]naphthalen-7-ol |
|---|---|
| PubChem CID | 90467252 |
| Molecular Formula | C21H37NOS |
| Molecular Weight | 351.60 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | 4,4,11b-trimethyl-6a-(methylaminomethyl)-9-(sulfanylmethyl)-1,2,3,4a,5,6,7,10,11,11a-decahydrocyclohepta[a]naphthalen-7-ol |
| SMILES | CNCC12CCC3C(C)(C)CCCC3(C)C1CCC(CS)=CC2O |
| InChI | InChI=1S/C21H37NOS/c1-19(2)9-5-10-20(3)16(19)8-11-21(14-22-4)17(20)7-6-15(13-24)12-18(21)23/h12,16-18,22-24H,5-11,13-14H2,1-4H3 |
| InChIKey | JKXXHVXVIZGOCZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|