C20H36N2O — CID 90467095
6a,9-bis(aminomethyl)-4,4,11b-trimethyl-1,2,3,4a,5,6,7,8,11,11a-decahydrocyclohepta[a]naphthalen-7-ol (PubChem CID 90467095) has the molecular formula C20H36N2O and a molecular weight of 320.52 g/mol. Its IUPAC name is 6a,9-bis(aminomethyl)-4,4,11b-trimethyl-1,2,3,4a,5,6,7,8,11,11a-decahydrocyclohepta[a]naphthalen-7-ol.
| Compound Name | 6a,9-bis(aminomethyl)-4,4,11b-trimethyl-1,2,3,4a,5,6,7,8,11,11a-decahydrocyclohepta[a]naphthalen-7-ol |
|---|---|
| PubChem CID | 90467095 |
| Molecular Formula | C20H36N2O |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.28 |
| IUPAC Name | 6a,9-bis(aminomethyl)-4,4,11b-trimethyl-1,2,3,4a,5,6,7,8,11,11a-decahydrocyclohepta[a]naphthalen-7-ol |
| SMILES | CC1(C)CCCC2(C)C1CCC1(CN)C(O)CC(CN)=CCC21 |
| InChI | InChI=1S/C20H36N2O/c1-18(2)8-4-9-19(3)15(18)7-10-20(13-22)16(19)6-5-14(12-21)11-17(20)23/h5,15-17,23H,4,6-13,21-22H2,1-3H3 |
| InChIKey | MIIUWJQVSPUVLV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|