C21H32O2 — CID 118421468
(6aR,7R,11bS)-4,4,7,11b-tetramethyl-1,2,3,4a,5,6,7,8,11,11a-decahydrocyclohepta[a]naphthalene-6a,9-dicarbaldehyde (PubChem CID 118421468) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is (6aR,7R,11bS)-4,4,7,11b-tetramethyl-1,2,3,4a,5,6,7,8,11,11a-decahydrocyclohepta[a]naphthalene-6a,9-dicarbaldehyde.
| Compound Name | (6aR,7R,11bS)-4,4,7,11b-tetramethyl-1,2,3,4a,5,6,7,8,11,11a-decahydrocyclohepta[a]naphthalene-6a,9-dicarbaldehyde |
|---|---|
| PubChem CID | 118421468 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (6aR,7R,11bS)-4,4,7,11b-tetramethyl-1,2,3,4a,5,6,7,8,11,11a-decahydrocyclohepta[a]naphthalene-6a,9-dicarbaldehyde |
| SMILES | C[C@@H]1CC(C=O)=CCC2[C@@]3(C)CCCC(C)(C)C3CC[C@]21C=O |
| InChI | InChI=1S/C21H32O2/c1-15-12-16(13-22)6-7-18-20(4)10-5-9-19(2,3)17(20)8-11-21(15,18)14-23/h6,13-15,17-18H,5,7-12H2,1-4H3/t15-,17?,18?,20+,21-/m1/s1 |
| InChIKey | HQECQINWVFFJSS-SDKHASNESA-N |
| XLogP | 4.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|