C20H28O2 — CID 162930383
4,4,11b-trimethyl-2,3,4a,5,6,6a,11,11a-octahydro-1H-cyclohepta[a]naphthalene-8,9-dicarbaldehyde (PubChem CID 162930383) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is 4,4,11b-trimethyl-2,3,4a,5,6,6a,11,11a-octahydro-1H-cyclohepta[a]naphthalene-8,9-dicarbaldehyde.
| Compound Name | 4,4,11b-trimethyl-2,3,4a,5,6,6a,11,11a-octahydro-1H-cyclohepta[a]naphthalene-8,9-dicarbaldehyde |
|---|---|
| PubChem CID | 162930383 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 4,4,11b-trimethyl-2,3,4a,5,6,6a,11,11a-octahydro-1H-cyclohepta[a]naphthalene-8,9-dicarbaldehyde |
| SMILES | CC1(C)CCCC2(C)C3CC=C(C=O)C(C=O)=CC3CCC12 |
| InChI | InChI=1S/C20H28O2/c1-19(2)9-4-10-20(3)17-7-5-15(12-21)16(13-22)11-14(17)6-8-18(19)20/h5,11-14,17-18H,4,6-10H2,1-3H3 |
| InChIKey | KONNXEJVCJUNNK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|