C35H58 — CID 10743294
(1S,5R,6S,11R,15R,23S)-1,5,6,7,11,15,19,19,23-nonamethylhexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-7-ene (PubChem CID 10743294) has the molecular formula C35H58 and a molecular weight of 478.85 g/mol. Its IUPAC name is (1S,5R,6S,11R,15R,23S)-1,5,6,7,11,15,19,19,23-nonamethylhexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-7-ene.
| Compound Name | (1S,5R,6S,11R,15R,23S)-1,5,6,7,11,15,19,19,23-nonamethylhexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-7-ene |
|---|---|
| PubChem CID | 10743294 |
| Molecular Formula | C35H58 |
| Molecular Weight | 478.85 g/mol |
| Exact Mass | 478.45 |
| IUPAC Name | (1S,5R,6S,11R,15R,23S)-1,5,6,7,11,15,19,19,23-nonamethylhexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-7-ene |
| SMILES | CC1=CCC2[C@]3(C)CCC4[C@]5(C)CCC6C(C)(C)CCC[C@]6(C)C5CC[C@]4(C)C3CC[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C35H58/c1-23-11-12-26-31(5,24(23)2)19-14-28-33(26,7)21-16-29-34(8)20-13-25-30(3,4)17-10-18-32(25,6)27(34)15-22-35(28,29)9/h11,24-29H,10,12-22H2,1-9H3/t24-,25?,26?,27?,28?,29?,31+,32-,33-,34+,35+/m0/s1 |
| InChIKey | GRGLSZKAJASSLX-HMQOGAFUSA-N |
| XLogP | 10.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.85 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|