C25H40O5 — CID 101025385
[(2S)-3-acetyloxy-2-hydroxypropyl] (1R,4aR,4bS,8aR,10aR)-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthrene-1-carboxylate (PubChem CID 101025385) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is [(2S)-3-acetyloxy-2-hydroxypropyl] (1R,4aR,4bS,8aR,10aR)-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthrene-1-carboxylate.
| Compound Name | [(2S)-3-acetyloxy-2-hydroxypropyl] (1R,4aR,4bS,8aR,10aR)-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 101025385 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | [(2S)-3-acetyloxy-2-hydroxypropyl] (1R,4aR,4bS,8aR,10aR)-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthrene-1-carboxylate |
| SMILES | CC(=O)OC[C@H](O)COC(=O)[C@@H]1C(C)=CC[C@H]2[C@@]1(C)CC[C@@H]1C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C25H40O5/c1-16-8-9-20-24(5)12-7-11-23(3,4)19(24)10-13-25(20,6)21(16)22(28)30-15-18(27)14-29-17(2)26/h8,18-21,27H,7,9-15H2,1-6H3/t18-,19+,20+,21-,24-,25+/m0/s1 |
| InChIKey | DYTUXZFSCGIMIU-HDSXVTNQSA-N |
| XLogP | 4.67 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|