C35H58O — CID 102094780
(2Z,6Z,10Z)-13-[(1S,4aS,4bR,8aR,10aR)-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthren-1-yl]-3,7,11-trimethyltrideca-2,6,10-trien-1-ol (PubChem CID 102094780) has the molecular formula C35H58O and a molecular weight of 494.85 g/mol. Its IUPAC name is (2Z,6Z,10Z)-13-[(1S,4aS,4bR,8aR,10aR)-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthren-1-yl]-3,7,11-trimethyltrideca-2,6,10-trien-1-ol.
| Compound Name | (2Z,6Z,10Z)-13-[(1S,4aS,4bR,8aR,10aR)-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthren-1-yl]-3,7,11-trimethyltrideca-2,6,10-trien-1-ol |
|---|---|
| PubChem CID | 102094780 |
| Molecular Formula | C35H58O |
| Molecular Weight | 494.85 g/mol |
| Exact Mass | 494.45 |
| IUPAC Name | (2Z,6Z,10Z)-13-[(1S,4aS,4bR,8aR,10aR)-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthren-1-yl]-3,7,11-trimethyltrideca-2,6,10-trien-1-ol |
| SMILES | CC1=CC[C@H]2[C@]3(C)CCCC(C)(C)[C@H]3CC[C@]2(C)[C@H]1CC/C(C)=C\CC/C(C)=C\CC/C(C)=C\CO |
| InChI | InChI=1S/C35H58O/c1-26(13-10-15-28(3)21-25-36)12-9-14-27(2)16-18-30-29(4)17-19-32-34(30,7)24-20-31-33(5,6)22-11-23-35(31,32)8/h13-14,17,21,30-32,36H,9-12,15-16,18-20,22-25H2,1-8H3/b26-13-,27-14-,28-21-/t30-,31+,32+,34+,35+/m0/s1 |
| InChIKey | TXTQQIZXTUHDCH-ONWHHDGISA-N |
| XLogP | 10.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.85 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|