C20H33I — CID 11047648
(1S,4aS,4bR,8aR,10aS)-1-(iodomethyl)-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthrene (PubChem CID 11047648) has the molecular formula C20H33I and a molecular weight of 400.39 g/mol. Its IUPAC name is (1S,4aS,4bR,8aR,10aS)-1-(iodomethyl)-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthrene.
| Compound Name | (1S,4aS,4bR,8aR,10aS)-1-(iodomethyl)-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthrene |
|---|---|
| PubChem CID | 11047648 |
| Molecular Formula | C20H33I |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (1S,4aS,4bR,8aR,10aS)-1-(iodomethyl)-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthrene |
| SMILES | CC1=CC[C@H]2[C@]3(C)CCCC(C)(C)[C@H]3CC[C@]2(C)[C@H]1CI |
| InChI | InChI=1S/C20H33I/c1-14-7-8-17-19(4,15(14)13-21)12-9-16-18(2,3)10-6-11-20(16,17)5/h7,15-17H,6,8-13H2,1-5H3/t15-,16+,17+,19+,20+/m0/s1 |
| InChIKey | JZESZVBBECNKHT-AZNNDXHDSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|