C23H40O2 — CID 102413382
9-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]nonanoic acid (PubChem CID 102413382) has the molecular formula C23H40O2 and a molecular weight of 348.57 g/mol. Its IUPAC name is 9-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]nonanoic acid.
| Compound Name | 9-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]nonanoic acid |
|---|---|
| PubChem CID | 102413382 |
| Molecular Formula | C23H40O2 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.30 |
| IUPAC Name | 9-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]nonanoic acid |
| SMILES | CC1=CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1CCCCCCCCC(=O)O |
| InChI | InChI=1S/C23H40O2/c1-18-14-15-20-22(2,3)16-11-17-23(20,4)19(18)12-9-7-5-6-8-10-13-21(24)25/h14,19-20H,5-13,15-17H2,1-4H3,(H,24,25)/t19-,20-,23+/m0/s1 |
| InChIKey | OOQMNKWWCYKRQU-SXWKCWPCSA-N |
| XLogP | 6.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|