C16H26O3 — CID 162886949
2-[2-(hydroxymethyl)-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]acetic acid (PubChem CID 162886949) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]acetic acid.
| Compound Name | 2-[2-(hydroxymethyl)-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]acetic acid |
|---|---|
| PubChem CID | 162886949 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 2-[2-(hydroxymethyl)-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]acetic acid |
| SMILES | CC1(C)CCCC2(C)C(CC(=O)O)C(CO)=CCC12 |
| InChI | InChI=1S/C16H26O3/c1-15(2)7-4-8-16(3)12(9-14(18)19)11(10-17)5-6-13(15)16/h5,12-13,17H,4,6-10H2,1-3H3,(H,18,19) |
| InChIKey | XEIZHYAQMSOIHJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|