C30H53NO3 — CID 118707328
6-pyrrolidin-1-ylhexyl (3S)-5-[(1R,4aS,8aS)-2-(hydroxymethyl)-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoate (PubChem CID 118707328) has the molecular formula C30H53NO3 and a molecular weight of 475.76 g/mol. Its IUPAC name is 6-pyrrolidin-1-ylhexyl (3S)-5-[(1R,4aS,8aS)-2-(hydroxymethyl)-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoate.
| Compound Name | 6-pyrrolidin-1-ylhexyl (3S)-5-[(1R,4aS,8aS)-2-(hydroxymethyl)-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoate |
|---|---|
| PubChem CID | 118707328 |
| Molecular Formula | C30H53NO3 |
| Molecular Weight | 475.76 g/mol |
| Exact Mass | 475.40 |
| IUPAC Name | 6-pyrrolidin-1-ylhexyl (3S)-5-[(1R,4aS,8aS)-2-(hydroxymethyl)-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoate |
| SMILES | C[C@@H](CC[C@H]1C(CO)=CC[C@H]2C(C)(C)CCC[C@]12C)CC(=O)OCCCCCCN1CCCC1 |
| InChI | InChI=1S/C30H53NO3/c1-24(22-28(33)34-21-10-6-5-7-18-31-19-8-9-20-31)12-14-26-25(23-32)13-15-27-29(2,3)16-11-17-30(26,27)4/h13,24,26-27,32H,5-12,14-23H2,1-4H3/t24-,26-,27-,30+/m0/s1 |
| InChIKey | JXHKDMRGJSLLTN-WJLKJTLYSA-N |
| XLogP | 6.76 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.76 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|