C22H40O2 — CID 58667500
ethyl 5-(2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)-3-methylpentanoate (PubChem CID 58667500) has the molecular formula C22H40O2 and a molecular weight of 336.56 g/mol. Its IUPAC name is ethyl 5-(2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)-3-methylpentanoate.
| Compound Name | ethyl 5-(2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)-3-methylpentanoate |
|---|---|
| PubChem CID | 58667500 |
| Molecular Formula | C22H40O2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.30 |
| IUPAC Name | ethyl 5-(2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)-3-methylpentanoate |
| SMILES | CCOC(=O)CC(C)CCC1C(C)CCC2C(C)(C)CCCC12C |
| InChI | InChI=1S/C22H40O2/c1-7-24-20(23)15-16(2)9-11-18-17(3)10-12-19-21(4,5)13-8-14-22(18,19)6/h16-19H,7-15H2,1-6H3 |
| InChIKey | GYEXMJYMXHOUEH-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |