C21H39NO — CID 67614500
(4S)-6-[(1S,2S,4aS,8aR)-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-4-methylhexanamide (PubChem CID 67614500) has the molecular formula C21H39NO and a molecular weight of 321.55 g/mol. Its IUPAC name is (4S)-6-[(1S,2S,4aS,8aR)-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-4-methylhexanamide.
| Compound Name | (4S)-6-[(1S,2S,4aS,8aR)-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-4-methylhexanamide |
|---|---|
| PubChem CID | 67614500 |
| Molecular Formula | C21H39NO |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.30 |
| IUPAC Name | (4S)-6-[(1S,2S,4aS,8aR)-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-4-methylhexanamide |
| SMILES | C[C@H](CCC(N)=O)CC[C@H]1[C@@H](C)CC[C@H]2C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C21H39NO/c1-15(8-12-19(22)23)7-10-17-16(2)9-11-18-20(3,4)13-6-14-21(17,18)5/h15-18H,6-14H2,1-5H3,(H2,22,23)/t15-,16-,17-,18-,21+/m0/s1 |
| InChIKey | UGPFWDBOLRAEKG-ZZAJSIFASA-N |
| XLogP | 5.55 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |