C21H36O3 — CID 134970540
methyl (1R,4aR)-1,4a,6-trimethyl-5-(4-methyl-3-oxopentyl)-2,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate (PubChem CID 134970540) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is methyl (1R,4aR)-1,4a,6-trimethyl-5-(4-methyl-3-oxopentyl)-2,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate.
| Compound Name | methyl (1R,4aR)-1,4a,6-trimethyl-5-(4-methyl-3-oxopentyl)-2,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 134970540 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | methyl (1R,4aR)-1,4a,6-trimethyl-5-(4-methyl-3-oxopentyl)-2,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@]2(C)C(CCC(=O)C(C)C)C(C)CCC21 |
| InChI | InChI=1S/C21H36O3/c1-14(2)17(22)10-9-16-15(3)8-11-18-20(16,4)12-7-13-21(18,5)19(23)24-6/h14-16,18H,7-13H2,1-6H3/t15?,16?,18?,20-,21-/m1/s1 |
| InChIKey | ZSXZXKJZSCWKAK-HGEUUBDMSA-N |
| XLogP | 5.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |