C20H40O7P2 — CID 166980234
[5-(2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)-3-methylpentyl] phosphono hydrogen phosphate (PubChem CID 166980234) has the molecular formula C20H40O7P2 and a molecular weight of 454.48 g/mol. Its IUPAC name is [5-(2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)-3-methylpentyl] phosphono hydrogen phosphate.
| Compound Name | [5-(2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)-3-methylpentyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 166980234 |
| Molecular Formula | C20H40O7P2 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | [5-(2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)-3-methylpentyl] phosphono hydrogen phosphate |
| SMILES | CC(CCOP(=O)(O)OP(=O)(O)O)CCC1C(C)CCC2C(C)(C)CCCC12C |
| InChI | InChI=1S/C20H40O7P2/c1-15(11-14-26-29(24,25)27-28(21,22)23)7-9-17-16(2)8-10-18-19(3,4)12-6-13-20(17,18)5/h15-18H,6-14H2,1-5H3,(H,24,25)(H2,21,22,23) |
| InChIKey | CFYNQQMSXSOLLY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|