C30H56 — CID 91752429
(1S,2R,4bR,10aR)-1-[(3S)-3,7-dimethylnonyl]-2,4b,8,8,10a-pentamethyl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthrene (PubChem CID 91752429) has the molecular formula C30H56 and a molecular weight of 416.78 g/mol. Its IUPAC name is (1S,2R,4bR,10aR)-1-[(3S)-3,7-dimethylnonyl]-2,4b,8,8,10a-pentamethyl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthrene.
| Compound Name | (1S,2R,4bR,10aR)-1-[(3S)-3,7-dimethylnonyl]-2,4b,8,8,10a-pentamethyl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthrene |
|---|---|
| PubChem CID | 91752429 |
| Molecular Formula | C30H56 |
| Molecular Weight | 416.78 g/mol |
| Exact Mass | 416.44 |
| IUPAC Name | (1S,2R,4bR,10aR)-1-[(3S)-3,7-dimethylnonyl]-2,4b,8,8,10a-pentamethyl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthrene |
| SMILES | CCC(C)CCC[C@H](C)CC[C@H]1[C@H](C)CCC2[C@]3(C)CCCC(C)(C)C3CC[C@@]21C |
| InChI | InChI=1S/C30H56/c1-9-22(2)12-10-13-23(3)14-16-25-24(4)15-17-27-29(25,7)21-18-26-28(5,6)19-11-20-30(26,27)8/h22-27H,9-21H2,1-8H3/t22?,23-,24+,25-,26?,27?,29+,30+/m0/s1 |
| InChIKey | LKFHRJUTBBHMDC-UUKDHTFHSA-N |
| XLogP | 9.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.78 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |