C25H46O — CID 14564449
(1S,2S,4aR,4bS,8aS,10aR)-2,4b,8,8,10a-pentamethyl-1-(3-methylpentyl)-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-ol (PubChem CID 14564449) has the molecular formula C25H46O and a molecular weight of 362.64 g/mol. Its IUPAC name is (1S,2S,4aR,4bS,8aS,10aR)-2,4b,8,8,10a-pentamethyl-1-(3-methylpentyl)-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-ol.
| Compound Name | (1S,2S,4aR,4bS,8aS,10aR)-2,4b,8,8,10a-pentamethyl-1-(3-methylpentyl)-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-ol |
|---|---|
| PubChem CID | 14564449 |
| Molecular Formula | C25H46O |
| Molecular Weight | 362.64 g/mol |
| Exact Mass | 362.35 |
| IUPAC Name | (1S,2S,4aR,4bS,8aS,10aR)-2,4b,8,8,10a-pentamethyl-1-(3-methylpentyl)-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-ol |
| SMILES | CCC(C)CC[C@H]1[C@]2(C)CC[C@H]3C(C)(C)CCC[C@]3(C)[C@H]2CC[C@]1(C)O |
| InChI | InChI=1S/C25H46O/c1-8-18(2)10-11-21-24(6)16-12-19-22(3,4)14-9-15-23(19,5)20(24)13-17-25(21,7)26/h18-21,26H,8-17H2,1-7H3/t18?,19-,20+,21-,23-,24+,25-/m0/s1 |
| InChIKey | ONLUNXPEZUYRTH-NYQIZBCBSA-N |
| XLogP | 7.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.64 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |