C16H30O — CID 76550157
1-ethyl-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol (PubChem CID 76550157) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is 1-ethyl-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol.
| Compound Name | 1-ethyl-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 76550157 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | 1-ethyl-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
| SMILES | CCC1C(C)(O)CCC2C(C)(C)CCCC21C |
| InChI | InChI=1S/C16H30O/c1-6-12-15(4)10-7-9-14(2,3)13(15)8-11-16(12,5)17/h12-13,17H,6-11H2,1-5H3 |
| InChIKey | QQKUSXUMFSIVSX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |