C16H30O4S — CID 76744348
(2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)methyl methanesulfonate (PubChem CID 76744348) has the molecular formula C16H30O4S and a molecular weight of 318.48 g/mol. Its IUPAC name is (2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)methyl methanesulfonate.
| Compound Name | (2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)methyl methanesulfonate |
|---|---|
| PubChem CID | 76744348 |
| Molecular Formula | C16H30O4S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)methyl methanesulfonate |
| SMILES | CC1(C)CCCC2(C)C1CCC(C)(O)C2COS(C)(=O)=O |
| InChI | InChI=1S/C16H30O4S/c1-14(2)8-6-9-15(3)12(14)7-10-16(4,17)13(15)11-20-21(5,18)19/h12-13,17H,6-11H2,1-5H3 |
| InChIKey | IYVYVIALZATQCM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|