C21H32O4 — CID 90280548
5-[[(1S,2R,4aS,8aR)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy]benzene-1,3-diol (PubChem CID 90280548) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is 5-[[(1S,2R,4aS,8aR)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy]benzene-1,3-diol.
| Compound Name | 5-[[(1S,2R,4aS,8aR)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy]benzene-1,3-diol |
|---|---|
| PubChem CID | 90280548 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 5-[[(1S,2R,4aS,8aR)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy]benzene-1,3-diol |
| SMILES | CC1(C)CCC[C@@]2(C)[C@@H](COc3cc(O)cc(O)c3)[C@](C)(O)CC[C@@H]12 |
| InChI | InChI=1S/C21H32O4/c1-19(2)7-5-8-20(3)17(19)6-9-21(4,24)18(20)13-25-16-11-14(22)10-15(23)12-16/h10-12,17-18,22-24H,5-9,13H2,1-4H3/t17-,18+,20+,21+/m0/s1 |
| InChIKey | SVCXFBAEALCOBX-UYWIDEMCSA-N |
| XLogP | 4.47 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |