C25H40O — CID 59707440
(1R,2R,8aS)-2,5,5,8a-tetramethyl-1-[(2,3,4,5-tetramethylphenyl)methyl]-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol (PubChem CID 59707440) has the molecular formula C25H40O and a molecular weight of 356.59 g/mol. Its IUPAC name is (1R,2R,8aS)-2,5,5,8a-tetramethyl-1-[(2,3,4,5-tetramethylphenyl)methyl]-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol.
| Compound Name | (1R,2R,8aS)-2,5,5,8a-tetramethyl-1-[(2,3,4,5-tetramethylphenyl)methyl]-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 59707440 |
| Molecular Formula | C25H40O |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 356.31 |
| IUPAC Name | (1R,2R,8aS)-2,5,5,8a-tetramethyl-1-[(2,3,4,5-tetramethylphenyl)methyl]-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
| SMILES | Cc1cc(C[C@@H]2[C@@]3(C)CCCC(C)(C)C3CC[C@@]2(C)O)c(C)c(C)c1C |
| InChI | InChI=1S/C25H40O/c1-16-14-20(19(4)18(3)17(16)2)15-22-24(7)12-9-11-23(5,6)21(24)10-13-25(22,8)26/h14,21-22,26H,9-13,15H2,1-8H3/t21?,22-,24+,25-/m1/s1 |
| InChIKey | CDEOSQHUKMMFLN-OCKALLHOSA-N |
| XLogP | 6.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |