C20H34O2 — CID 101225091
(1R,2R,8aS)-2,5,5,8a-tetramethyl-1-[[(2S)-3-methyl-2,5-dihydrofuran-2-yl]methyl]-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol (PubChem CID 101225091) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (1R,2R,8aS)-2,5,5,8a-tetramethyl-1-[[(2S)-3-methyl-2,5-dihydrofuran-2-yl]methyl]-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol.
| Compound Name | (1R,2R,8aS)-2,5,5,8a-tetramethyl-1-[[(2S)-3-methyl-2,5-dihydrofuran-2-yl]methyl]-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 101225091 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (1R,2R,8aS)-2,5,5,8a-tetramethyl-1-[[(2S)-3-methyl-2,5-dihydrofuran-2-yl]methyl]-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
| SMILES | CC1=CCO[C@H]1C[C@@H]1[C@@]2(C)CCCC(C)(C)C2CC[C@@]1(C)O |
| InChI | InChI=1S/C20H34O2/c1-14-8-12-22-15(14)13-17-19(4)10-6-9-18(2,3)16(19)7-11-20(17,5)21/h8,15-17,21H,6-7,9-13H2,1-5H3/t15-,16?,17+,19-,20+/m0/s1 |
| InChIKey | TYOCYSYZCMGKPO-AWOULIKDSA-N |
| XLogP | 4.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|