C22H32O2 — CID 123845529
3-[(2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl)methoxy]-5-methylphenol (PubChem CID 123845529) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is 3-[(2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl)methoxy]-5-methylphenol.
| Compound Name | 3-[(2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl)methoxy]-5-methylphenol |
|---|---|
| PubChem CID | 123845529 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 3-[(2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl)methoxy]-5-methylphenol |
| SMILES | CC1=CCC2C(C)(C)CCCC2(C)C1COc1cc(C)cc(O)c1 |
| InChI | InChI=1S/C22H32O2/c1-15-11-17(23)13-18(12-15)24-14-19-16(2)7-8-20-21(3,4)9-6-10-22(19,20)5/h7,11-13,19-20,23H,6,8-10,14H2,1-5H3 |
| InChIKey | MWCNNMDTZBKQHW-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|