C21H36O — CID 134785769
(4aS,8R,8aS)-8-[(3S)-3-methoxy-3-methylpent-4-enyl]-4,4,7,8a-tetramethyl-1,2,3,4a,5,8-hexahydronaphthalene (PubChem CID 134785769) has the molecular formula C21H36O and a molecular weight of 304.52 g/mol. Its IUPAC name is (4aS,8R,8aS)-8-[(3S)-3-methoxy-3-methylpent-4-enyl]-4,4,7,8a-tetramethyl-1,2,3,4a,5,8-hexahydronaphthalene.
| Compound Name | (4aS,8R,8aS)-8-[(3S)-3-methoxy-3-methylpent-4-enyl]-4,4,7,8a-tetramethyl-1,2,3,4a,5,8-hexahydronaphthalene |
|---|---|
| PubChem CID | 134785769 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | (4aS,8R,8aS)-8-[(3S)-3-methoxy-3-methylpent-4-enyl]-4,4,7,8a-tetramethyl-1,2,3,4a,5,8-hexahydronaphthalene |
| SMILES | C=C[C@](C)(CC[C@@H]1C(C)=CC[C@H]2C(C)(C)CCC[C@]12C)OC |
| InChI | InChI=1S/C21H36O/c1-8-20(5,22-7)15-12-17-16(2)10-11-18-19(3,4)13-9-14-21(17,18)6/h8,10,17-18H,1,9,11-15H2,2-7H3/t17-,18+,20-,21-/m1/s1 |
| InChIKey | ZWCHJTGMHXJGEA-KOUHRCEDSA-N |
| XLogP | 6.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|