C19H34O3 — CID 166980207
4-(2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)butan-2-yl formate (PubChem CID 166980207) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is 4-(2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)butan-2-yl formate.
| Compound Name | 4-(2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)butan-2-yl formate |
|---|---|
| PubChem CID | 166980207 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | 4-(2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)butan-2-yl formate |
| SMILES | CC(CCC1C(C)(O)CCC2C(C)(C)CCCC21C)OC=O |
| InChI | InChI=1S/C19H34O3/c1-14(22-13-20)7-8-16-18(4)11-6-10-17(2,3)15(18)9-12-19(16,5)21/h13-16,21H,6-12H2,1-5H3 |
| InChIKey | VTOLUJVKIWQNLP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|