C19H32O2 — CID 155469302
[(2S)-4-[(1S,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]butan-2-yl] formate (PubChem CID 155469302) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is [(2S)-4-[(1S,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]butan-2-yl] formate.
| Compound Name | [(2S)-4-[(1S,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]butan-2-yl] formate |
|---|---|
| PubChem CID | 155469302 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | [(2S)-4-[(1S,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]butan-2-yl] formate |
| SMILES | C=C1CCC2C(C)(C)CCC[C@]2(C)[C@H]1CC[C@H](C)OC=O |
| InChI | InChI=1S/C19H32O2/c1-14-7-10-17-18(3,4)11-6-12-19(17,5)16(14)9-8-15(2)21-13-20/h13,15-17H,1,6-12H2,2-5H3/t15-,16-,17?,19+/m0/s1 |
| InChIKey | MUACEOSXDOOJCP-SRDAIODESA-N |
| XLogP | 5.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|