C20H36 — CID 153391734
8-(2-ethylbutyl)-4,4,8a-trimethyl-7-methylidene-2,3,4a,5,6,8-hexahydro-1H-naphthalene (PubChem CID 153391734) has the molecular formula C20H36 and a molecular weight of 276.51 g/mol. Its IUPAC name is 8-(2-ethylbutyl)-4,4,8a-trimethyl-7-methylidene-2,3,4a,5,6,8-hexahydro-1H-naphthalene.
| Compound Name | 8-(2-ethylbutyl)-4,4,8a-trimethyl-7-methylidene-2,3,4a,5,6,8-hexahydro-1H-naphthalene |
|---|---|
| PubChem CID | 153391734 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | 8-(2-ethylbutyl)-4,4,8a-trimethyl-7-methylidene-2,3,4a,5,6,8-hexahydro-1H-naphthalene |
| SMILES | C=C1CCC2C(C)(C)CCCC2(C)C1CC(CC)CC |
| InChI | InChI=1S/C20H36/c1-7-16(8-2)14-17-15(3)10-11-18-19(4,5)12-9-13-20(17,18)6/h16-18H,3,7-14H2,1-2,4-6H3 |
| InChIKey | VDIROKJVYUOPSF-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|