C19H30O3 — CID 164767548
(E)-4-[(8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-2-(hydroxymethyl)but-2-enoic acid (PubChem CID 164767548) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (E)-4-[(8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-2-(hydroxymethyl)but-2-enoic acid.
| Compound Name | (E)-4-[(8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-2-(hydroxymethyl)but-2-enoic acid |
|---|---|
| PubChem CID | 164767548 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (E)-4-[(8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-2-(hydroxymethyl)but-2-enoic acid |
| SMILES | C=C1CCC2C(C)(C)CCC[C@]2(C)C1C/C=C(\CO)C(=O)O |
| InChI | InChI=1S/C19H30O3/c1-13-6-9-16-18(2,3)10-5-11-19(16,4)15(13)8-7-14(12-20)17(21)22/h7,15-16,20H,1,5-6,8-12H2,2-4H3,(H,21,22)/b14-7+/t15?,16?,19-/m1/s1 |
| InChIKey | NWJIMAKIIBKPPT-JTOFWFEUSA-N |
| XLogP | 4.18 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|